C22H21FN2O5 — CID 46599885
N-[2-(4-fluorophenoxy)ethyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide (PubChem CID 46599885) has the molecular formula C22H21FN2O5 and a molecular weight of 412.42 g/mol. Its IUPAC name is N-[2-(4-fluorophenoxy)ethyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-[2-(4-fluorophenoxy)ethyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 46599885 |
| Molecular Formula | C22H21FN2O5 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-[2-(4-fluorophenoxy)ethyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
| SMILES | O=C(NCCOc1ccc(F)cc1)c1ccc2c(c1)C(=O)N(CC1CCCO1)C2=O |
| InChI | InChI=1S/C22H21FN2O5/c23-15-4-6-16(7-5-15)30-11-9-24-20(26)14-3-8-18-19(12-14)22(28)25(21(18)27)13-17-2-1-10-29-17/h3-8,12,17H,1-2,9-11,13H2,(H,24,26) |
| InChIKey | BVKZGTWJKQWDMX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|