C20H26ClN3O4 — CID 119534575
1,3-dioxo-2-(oxolan-2-ylmethyl)-N-(2-pyrrolidin-3-ylethyl)isoindole-5-carboxamide;hydrochloride (PubChem CID 119534575) has the molecular formula C20H26ClN3O4 and a molecular weight of 407.90 g/mol. Its IUPAC name is 1,3-dioxo-2-(oxolan-2-ylmethyl)-N-(2-pyrrolidin-3-ylethyl)isoindole-5-carboxamide;hydrochloride.
| Compound Name | 1,3-dioxo-2-(oxolan-2-ylmethyl)-N-(2-pyrrolidin-3-ylethyl)isoindole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119534575 |
| Molecular Formula | C20H26ClN3O4 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 1,3-dioxo-2-(oxolan-2-ylmethyl)-N-(2-pyrrolidin-3-ylethyl)isoindole-5-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCC1CCNC1)c1ccc2c(c1)C(=O)N(CC1CCCO1)C2=O |
| InChI | InChI=1S/C20H25N3O4.ClH/c24-18(22-8-6-13-5-7-21-11-13)14-3-4-16-17(10-14)20(26)23(19(16)25)12-15-2-1-9-27-15;/h3-4,10,13,15,21H,1-2,5-9,11-12H2,(H,22,24);1H |
| InChIKey | ORGYUJXNZLZJGX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|