C19H22N2O4 — CID 38656070
N-(cyclobutylmethyl)-1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindole-5-carboxamide (PubChem CID 38656070) has the molecular formula C19H22N2O4 and a molecular weight of 342.39 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindole-5-carboxamide.
| Compound Name | N-(cyclobutylmethyl)-1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 38656070 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-(cyclobutylmethyl)-1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindole-5-carboxamide |
| SMILES | O=C(NCC1CCC1)c1ccc2c(c1)C(=O)N(C[C@H]1CCCO1)C2=O |
| InChI | InChI=1S/C19H22N2O4/c22-17(20-10-12-3-1-4-12)13-6-7-15-16(9-13)19(24)21(18(15)23)11-14-5-2-8-25-14/h6-7,9,12,14H,1-5,8,10-11H2,(H,20,22)/t14-/m1/s1 |
| InChIKey | GTVRTXRSRNOTPE-CQSZACIVSA-N |
| XLogP | 1.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|