C17H18N2O4 — CID 18083848
1,3-dioxo-N-(oxolan-2-ylmethyl)-2-prop-2-enylisoindole-5-carboxamide (PubChem CID 18083848) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 1,3-dioxo-N-(oxolan-2-ylmethyl)-2-prop-2-enylisoindole-5-carboxamide.
| Compound Name | 1,3-dioxo-N-(oxolan-2-ylmethyl)-2-prop-2-enylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 18083848 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1,3-dioxo-N-(oxolan-2-ylmethyl)-2-prop-2-enylisoindole-5-carboxamide |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)NCC3CCCO3)cc2C1=O |
| InChI | InChI=1S/C17H18N2O4/c1-2-7-19-16(21)13-6-5-11(9-14(13)17(19)22)15(20)18-10-12-4-3-8-23-12/h2,5-6,9,12H,1,3-4,7-8,10H2,(H,18,20) |
| InChIKey | LNGJYFSTUIXADA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|