C19H18N2O5 — CID 7394298
2-(furan-2-ylmethyl)-1,3-dioxo-N-[[(2S)-oxolan-2-yl]methyl]isoindole-5-carboxamide (PubChem CID 7394298) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)-1,3-dioxo-N-[[(2S)-oxolan-2-yl]methyl]isoindole-5-carboxamide.
| Compound Name | 2-(furan-2-ylmethyl)-1,3-dioxo-N-[[(2S)-oxolan-2-yl]methyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 7394298 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-(furan-2-ylmethyl)-1,3-dioxo-N-[[(2S)-oxolan-2-yl]methyl]isoindole-5-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C19H18N2O5/c22-17(20-10-13-3-1-7-25-13)12-5-6-15-16(9-12)19(24)21(18(15)23)11-14-4-2-8-26-14/h2,4-6,8-9,13H,1,3,7,10-11H2,(H,20,22)/t13-/m0/s1 |
| InChIKey | ZMRYTAGYBXNINB-ZDUSSCGKSA-N |
| XLogP | 1.98 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|