C26H27N3O6 — CID 28958348
1,3-dioxo-N-[[(2S)-oxolan-2-yl]methyl]-2-[4-[[(2S)-oxolan-2-yl]methylcarbamoyl]phenyl]isoindole-5-carboxamide (PubChem CID 28958348) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is 1,3-dioxo-N-[[(2S)-oxolan-2-yl]methyl]-2-[4-[[(2S)-oxolan-2-yl]methylcarbamoyl]phenyl]isoindole-5-carboxamide.
| Compound Name | 1,3-dioxo-N-[[(2S)-oxolan-2-yl]methyl]-2-[4-[[(2S)-oxolan-2-yl]methylcarbamoyl]phenyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 28958348 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 1,3-dioxo-N-[[(2S)-oxolan-2-yl]methyl]-2-[4-[[(2S)-oxolan-2-yl]methylcarbamoyl]phenyl]isoindole-5-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)c1ccc(N2C(=O)c3ccc(C(=O)NC[C@@H]4CCCO4)cc3C2=O)cc1 |
| InChI | InChI=1S/C26H27N3O6/c30-23(27-14-19-3-1-11-34-19)16-5-8-18(9-6-16)29-25(32)21-10-7-17(13-22(21)26(29)33)24(31)28-15-20-4-2-12-35-20/h5-10,13,19-20H,1-4,11-12,14-15H2,(H,27,30)(H,28,31)/t19-,20-/m0/s1 |
| InChIKey | OOLPRQUGRIMNCE-PMACEKPBSA-N |
| XLogP | 2.30 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|