C20H17NO4 — CID 42559548
9,10-dioxo-N-[[(2S)-oxolan-2-yl]methyl]anthracene-2-carboxamide (PubChem CID 42559548) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is 9,10-dioxo-N-[[(2S)-oxolan-2-yl]methyl]anthracene-2-carboxamide.
| Compound Name | 9,10-dioxo-N-[[(2S)-oxolan-2-yl]methyl]anthracene-2-carboxamide |
|---|---|
| PubChem CID | 42559548 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 9,10-dioxo-N-[[(2S)-oxolan-2-yl]methyl]anthracene-2-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H17NO4/c22-18-14-5-1-2-6-15(14)19(23)17-10-12(7-8-16(17)18)20(24)21-11-13-4-3-9-25-13/h1-2,5-8,10,13H,3-4,9,11H2,(H,21,24)/t13-/m0/s1 |
| InChIKey | ZDLYLQPXOBEDQA-ZDUSSCGKSA-N |
| XLogP | 2.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|