C16H20N2O3 — CID 109050678
3-N-cyclopropyl-1-N-(oxolan-2-ylmethyl)benzene-1,3-dicarboxamide (PubChem CID 109050678) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-N-cyclopropyl-1-N-(oxolan-2-ylmethyl)benzene-1,3-dicarboxamide.
| Compound Name | 3-N-cyclopropyl-1-N-(oxolan-2-ylmethyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109050678 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 3-N-cyclopropyl-1-N-(oxolan-2-ylmethyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(NCC1CCCO1)c1cccc(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C16H20N2O3/c19-15(17-10-14-5-2-8-21-14)11-3-1-4-12(9-11)16(20)18-13-6-7-13/h1,3-4,9,13-14H,2,5-8,10H2,(H,17,19)(H,18,20) |
| InChIKey | GFAOFBBTDMSBNZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |