C23H23N3O5 — CID 17361782
2-ethyl-1,3-dioxo-N-[2-(oxolan-2-ylmethylcarbamoyl)phenyl]isoindole-5-carboxamide (PubChem CID 17361782) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is 2-ethyl-1,3-dioxo-N-[2-(oxolan-2-ylmethylcarbamoyl)phenyl]isoindole-5-carboxamide.
| Compound Name | 2-ethyl-1,3-dioxo-N-[2-(oxolan-2-ylmethylcarbamoyl)phenyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 17361782 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-ethyl-1,3-dioxo-N-[2-(oxolan-2-ylmethylcarbamoyl)phenyl]isoindole-5-carboxamide |
| SMILES | CCN1C(=O)c2ccc(C(=O)Nc3ccccc3C(=O)NCC3CCCO3)cc2C1=O |
| InChI | InChI=1S/C23H23N3O5/c1-2-26-22(29)16-10-9-14(12-18(16)23(26)30)20(27)25-19-8-4-3-7-17(19)21(28)24-13-15-6-5-11-31-15/h3-4,7-10,12,15H,2,5-6,11,13H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | YCCTXQHUEUTPMW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|