C21H17N2O6- — CID 6982548
2-[[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindole-5-carbonyl]amino]benzoate (PubChem CID 6982548) has the molecular formula C21H17N2O6- and a molecular weight of 393.38 g/mol. Its IUPAC name is 2-[[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindole-5-carbonyl]amino]benzoate.
| Compound Name | 2-[[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindole-5-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 6982548 |
| Molecular Formula | C21H17N2O6- |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 2-[[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindole-5-carbonyl]amino]benzoate |
| SMILES | O=C(Nc1ccccc1C(=O)[O-])c1ccc2c(c1)C(=O)N(C[C@@H]1CCCO1)C2=O |
| InChI | InChI=1S/C21H18N2O6/c24-18(22-17-6-2-1-5-15(17)21(27)28)12-7-8-14-16(10-12)20(26)23(19(14)25)11-13-4-3-9-29-13/h1-2,5-8,10,13H,3-4,9,11H2,(H,22,24)(H,27,28)/p-1/t13-/m0/s1 |
| InChIKey | SUKIGNZYFFRPOG-ZDUSSCGKSA-M |
| XLogP | 1.08 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|