C27H25N3O7 — CID 17362324
N-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide (PubChem CID 17362324) has the molecular formula C27H25N3O7 and a molecular weight of 503.51 g/mol. Its IUPAC name is N-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 17362324 |
| Molecular Formula | C27H25N3O7 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | N-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)N(CC1CCCO1)C2=O)c1ccc2c(c1)C(=O)N(CC1CCCO1)C2=O |
| InChI | InChI=1S/C27H25N3O7/c31-23(15-5-7-19-21(11-15)26(34)29(24(19)32)13-17-3-1-9-36-17)28-16-6-8-20-22(12-16)27(35)30(25(20)33)14-18-4-2-10-37-18/h5-8,11-12,17-18H,1-4,9-10,13-14H2,(H,28,31) |
| InChIKey | UYMJHEZIZGYYHC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|