C22H20FN3O5 — CID 55531666
N-(3-acetamido-4-fluorophenyl)-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide (PubChem CID 55531666) has the molecular formula C22H20FN3O5 and a molecular weight of 425.42 g/mol. Its IUPAC name is N-(3-acetamido-4-fluorophenyl)-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-(3-acetamido-4-fluorophenyl)-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 55531666 |
| Molecular Formula | C22H20FN3O5 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-(3-acetamido-4-fluorophenyl)-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
| SMILES | CC(=O)Nc1cc(NC(=O)c2ccc3c(c2)C(=O)N(CC2CCCO2)C3=O)ccc1F |
| InChI | InChI=1S/C22H20FN3O5/c1-12(27)24-19-10-14(5-7-18(19)23)25-20(28)13-4-6-16-17(9-13)22(30)26(21(16)29)11-15-3-2-8-31-15/h4-7,9-10,15H,2-3,8,11H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | OOVUHVMAOSLGCH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|