C22H18ClFN2O6 — CID 55322712
[2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylate (PubChem CID 55322712) has the molecular formula C22H18ClFN2O6 and a molecular weight of 460.85 g/mol. Its IUPAC name is [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylate.
| Compound Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylate |
|---|---|
| PubChem CID | 55322712 |
| Molecular Formula | C22H18ClFN2O6 |
| Molecular Weight | 460.85 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)C(=O)N(CC1CCCO1)C2=O)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C22H18ClFN2O6/c23-13-4-6-17(24)18(9-13)25-19(27)11-32-22(30)12-3-5-15-16(8-12)21(29)26(20(15)28)10-14-2-1-7-31-14/h3-6,8-9,14H,1-2,7,10-11H2,(H,25,27) |
| InChIKey | MSJPOUFMOODFJU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.85 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|