C22H19BrN2O6 — CID 31654269
[2-(4-bromoanilino)-2-oxoethyl] 1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindole-5-carboxylate (PubChem CID 31654269) has the molecular formula C22H19BrN2O6 and a molecular weight of 487.31 g/mol. Its IUPAC name is [2-(4-bromoanilino)-2-oxoethyl] 1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindole-5-carboxylate.
| Compound Name | [2-(4-bromoanilino)-2-oxoethyl] 1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindole-5-carboxylate |
|---|---|
| PubChem CID | 31654269 |
| Molecular Formula | C22H19BrN2O6 |
| Molecular Weight | 487.31 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | [2-(4-bromoanilino)-2-oxoethyl] 1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)C(=O)N(C[C@@H]1CCCO1)C2=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H19BrN2O6/c23-14-4-6-15(7-5-14)24-19(26)12-31-22(29)13-3-8-17-18(10-13)21(28)25(20(17)27)11-16-2-1-9-30-16/h3-8,10,16H,1-2,9,11-12H2,(H,24,26)/t16-/m0/s1 |
| InChIKey | IYKZQOHKLWMWHX-INIZCTEOSA-N |
| XLogP | 3.02 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|