C22H20N2O7 — CID 46648216
[2-(4-hydroxyanilino)-2-oxoethyl] 1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylate (PubChem CID 46648216) has the molecular formula C22H20N2O7 and a molecular weight of 424.41 g/mol. Its IUPAC name is [2-(4-hydroxyanilino)-2-oxoethyl] 1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylate.
| Compound Name | [2-(4-hydroxyanilino)-2-oxoethyl] 1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylate |
|---|---|
| PubChem CID | 46648216 |
| Molecular Formula | C22H20N2O7 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | [2-(4-hydroxyanilino)-2-oxoethyl] 1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)C(=O)N(CC1CCCO1)C2=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C22H20N2O7/c25-15-6-4-14(5-7-15)23-19(26)12-31-22(29)13-3-8-17-18(10-13)21(28)24(20(17)27)11-16-2-1-9-30-16/h3-8,10,16,25H,1-2,9,11-12H2,(H,23,26) |
| InChIKey | GZHHSJZBPFSWLN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|