C22H18Cl2N2O6 — CID 1410740
[2-(2,5-dichloroanilino)-2-oxoethyl] 1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindole-5-carboxylate (PubChem CID 1410740) has the molecular formula C22H18Cl2N2O6 and a molecular weight of 477.30 g/mol. Its IUPAC name is [2-(2,5-dichloroanilino)-2-oxoethyl] 1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindole-5-carboxylate.
| Compound Name | [2-(2,5-dichloroanilino)-2-oxoethyl] 1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindole-5-carboxylate |
|---|---|
| PubChem CID | 1410740 |
| Molecular Formula | C22H18Cl2N2O6 |
| Molecular Weight | 477.30 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | [2-(2,5-dichloroanilino)-2-oxoethyl] 1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)C(=O)N(C[C@H]1CCCO1)C2=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C22H18Cl2N2O6/c23-13-4-6-17(24)18(9-13)25-19(27)11-32-22(30)12-3-5-15-16(8-12)21(29)26(20(15)28)10-14-2-1-7-31-14/h3-6,8-9,14H,1-2,7,10-11H2,(H,25,27)/t14-/m1/s1 |
| InChIKey | CQNHKXATOIOYSB-CQSZACIVSA-N |
| XLogP | 3.56 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|