C23H21ClN2O6 — CID 55461242
N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide (PubChem CID 55461242) has the molecular formula C23H21ClN2O6 and a molecular weight of 456.88 g/mol. Its IUPAC name is N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 55461242 |
| Molecular Formula | C23H21ClN2O6 |
| Molecular Weight | 456.88 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
| SMILES | O=C(Nc1cc2c(cc1Cl)OCCCO2)c1ccc2c(c1)C(=O)N(CC1CCCO1)C2=O |
| InChI | InChI=1S/C23H21ClN2O6/c24-17-10-19-20(32-8-2-7-31-19)11-18(17)25-21(27)13-4-5-15-16(9-13)23(29)26(22(15)28)12-14-3-1-6-30-14/h4-5,9-11,14H,1-3,6-8,12H2,(H,25,27) |
| InChIKey | UHJXUEBXDRHXAR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.88 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|