C21H22ClN3O5 — CID 119420902
N-(2-amino-5-methoxyphenyl)-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide;hydrochloride (PubChem CID 119420902) has the molecular formula C21H22ClN3O5 and a molecular weight of 431.88 g/mol. Its IUPAC name is N-(2-amino-5-methoxyphenyl)-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-5-methoxyphenyl)-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119420902 |
| Molecular Formula | C21H22ClN3O5 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-(2-amino-5-methoxyphenyl)-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide;hydrochloride |
| SMILES | COc1ccc(N)c(NC(=O)c2ccc3c(c2)C(=O)N(CC2CCCO2)C3=O)c1.Cl |
| InChI | InChI=1S/C21H21N3O5.ClH/c1-28-13-5-7-17(22)18(10-13)23-19(25)12-4-6-15-16(9-12)21(27)24(20(15)26)11-14-3-2-8-29-14;/h4-7,9-10,14H,2-3,8,11,22H2,1H3,(H,23,25);1H |
| InChIKey | HLBGEVDYUNLUQA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|