C16H17ClN2O4 — CID 40869687
3-chloro-N-[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindol-5-yl]propanamide (PubChem CID 40869687) has the molecular formula C16H17ClN2O4 and a molecular weight of 336.78 g/mol. Its IUPAC name is 3-chloro-N-[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindol-5-yl]propanamide.
| Compound Name | 3-chloro-N-[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindol-5-yl]propanamide |
|---|---|
| PubChem CID | 40869687 |
| Molecular Formula | C16H17ClN2O4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 3-chloro-N-[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindol-5-yl]propanamide |
| SMILES | O=C(CCCl)Nc1ccc2c(c1)C(=O)N(C[C@@H]1CCCO1)C2=O |
| InChI | InChI=1S/C16H17ClN2O4/c17-6-5-14(20)18-10-3-4-12-13(8-10)16(22)19(15(12)21)9-11-2-1-7-23-11/h3-4,8,11H,1-2,5-7,9H2,(H,18,20)/t11-/m0/s1 |
| InChIKey | LHJRQKJISXMMEX-NSHDSACASA-N |
| XLogP | 2.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|