C18H20N2O5 — CID 9324664
(2R)-N-[1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindol-5-yl]oxolane-2-carboxamide (PubChem CID 9324664) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is (2R)-N-[1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindol-5-yl]oxolane-2-carboxamide.
| Compound Name | (2R)-N-[1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindol-5-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 9324664 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (2R)-N-[1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindol-5-yl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)N(C[C@H]1CCCO1)C2=O)[C@H]1CCCO1 |
| InChI | InChI=1S/C18H20N2O5/c21-16(15-4-2-8-25-15)19-11-5-6-13-14(9-11)18(23)20(17(13)22)10-12-3-1-7-24-12/h5-6,9,12,15H,1-4,7-8,10H2,(H,19,21)/t12-,15-/m1/s1 |
| InChIKey | RTJPOJRRQZVGDY-IUODEOHRSA-N |
| XLogP | 1.58 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|