C18H15BrN2O5 — CID 17296711
5-bromo-N-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]furan-2-carboxamide (PubChem CID 17296711) has the molecular formula C18H15BrN2O5 and a molecular weight of 419.23 g/mol. Its IUPAC name is 5-bromo-N-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17296711 |
| Molecular Formula | C18H15BrN2O5 |
| Molecular Weight | 419.23 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | 5-bromo-N-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)N(CC1CCCO1)C2=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C18H15BrN2O5/c19-15-6-5-14(26-15)16(22)20-10-3-4-12-13(8-10)18(24)21(17(12)23)9-11-2-1-7-25-11/h3-6,8,11H,1-2,7,9H2,(H,20,22) |
| InChIKey | RNAKWUWCYZCNQZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|