C16H19ClN2O4 — CID 168638640
5-[(3-chloro-2-hydroxypropyl)amino]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione (PubChem CID 168638640) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is 5-[(3-chloro-2-hydroxypropyl)amino]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione.
| Compound Name | 5-[(3-chloro-2-hydroxypropyl)amino]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168638640 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 5-[(3-chloro-2-hydroxypropyl)amino]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccc(NCC(O)CCl)cc2C(=O)N1CC1CCCO1 |
| InChI | InChI=1S/C16H19ClN2O4/c17-7-11(20)8-18-10-3-4-13-14(6-10)16(22)19(15(13)21)9-12-2-1-5-23-12/h3-4,6,11-12,18,20H,1-2,5,7-9H2 |
| InChIKey | QWTWWAXPYDHTKX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|