C26H24N2O7 — CID 1231025
5-[1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindol-5-yl]oxy-2-[[(2S)-oxolan-2-yl]methyl]isoindole-1,3-dione (PubChem CID 1231025) has the molecular formula C26H24N2O7 and a molecular weight of 476.49 g/mol. Its IUPAC name is 5-[1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindol-5-yl]oxy-2-[[(2S)-oxolan-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 5-[1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindol-5-yl]oxy-2-[[(2S)-oxolan-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 1231025 |
| Molecular Formula | C26H24N2O7 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 5-[1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindol-5-yl]oxy-2-[[(2S)-oxolan-2-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccc(Oc3ccc4c(c3)C(=O)N(C[C@@H]3CCCO3)C4=O)cc2C(=O)N1C[C@H]1CCCO1 |
| InChI | InChI=1S/C26H24N2O7/c29-23-19-7-5-15(11-21(19)25(31)27(23)13-17-3-1-9-33-17)35-16-6-8-20-22(12-16)26(32)28(24(20)30)14-18-4-2-10-34-18/h5-8,11-12,17-18H,1-4,9-10,13-14H2/t17-,18+ |
| InChIKey | FQVWWQPIOWSDCZ-HDICACEKSA-N |
| XLogP | 3.03 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|