C21H17F3N2O5 — CID 40975457
N-[4-[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindol-5-yl]oxyphenyl]-2,2,2-trifluoroacetamide (PubChem CID 40975457) has the molecular formula C21H17F3N2O5 and a molecular weight of 434.37 g/mol. Its IUPAC name is N-[4-[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindol-5-yl]oxyphenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindol-5-yl]oxyphenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 40975457 |
| Molecular Formula | C21H17F3N2O5 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | N-[4-[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindol-5-yl]oxyphenyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C1c2ccc(Oc3ccc(NC(=O)C(F)(F)F)cc3)cc2C(=O)N1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C21H17F3N2O5/c22-21(23,24)20(29)25-12-3-5-13(6-4-12)31-14-7-8-16-17(10-14)19(28)26(18(16)27)11-15-2-1-9-30-15/h3-8,10,15H,1-2,9,11H2,(H,25,29)/t15-/m0/s1 |
| InChIKey | AXEBAKNZHDNRKQ-HNNXBMFYSA-N |
| XLogP | 3.75 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|