C29H28N2O6 — CID 17362491
N-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-phenoxybutanamide (PubChem CID 17362491) has the molecular formula C29H28N2O6 and a molecular weight of 500.55 g/mol. Its IUPAC name is N-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-phenoxybutanamide.
| Compound Name | N-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-phenoxybutanamide |
|---|---|
| PubChem CID | 17362491 |
| Molecular Formula | C29H28N2O6 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | N-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-phenoxybutanamide |
| SMILES | CCC(Oc1ccccc1)C(=O)Nc1ccc(Oc2ccc3c(c2)C(=O)N(CC2CCCO2)C3=O)cc1 |
| InChI | InChI=1S/C29H28N2O6/c1-2-26(37-20-7-4-3-5-8-20)27(32)30-19-10-12-21(13-11-19)36-22-14-15-24-25(17-22)29(34)31(28(24)33)18-23-9-6-16-35-23/h3-5,7-8,10-15,17,23,26H,2,6,9,16,18H2,1H3,(H,30,32) |
| InChIKey | NLPMMOGFUVDXJP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|