C30H30N2O6 — CID 17362136
2-(3,4-dimethylphenoxy)-N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]propanamide (PubChem CID 17362136) has the molecular formula C30H30N2O6 and a molecular weight of 514.58 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]propanamide.
| Compound Name | 2-(3,4-dimethylphenoxy)-N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]propanamide |
|---|---|
| PubChem CID | 17362136 |
| Molecular Formula | C30H30N2O6 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]propanamide |
| SMILES | Cc1ccc(OC(C)C(=O)Nc2cccc(Oc3ccc4c(c3)C(=O)N(CC3CCCO3)C4=O)c2)cc1C |
| InChI | InChI=1S/C30H30N2O6/c1-18-9-10-23(14-19(18)2)37-20(3)28(33)31-21-6-4-7-22(15-21)38-24-11-12-26-27(16-24)30(35)32(29(26)34)17-25-8-5-13-36-25/h4,6-7,9-12,14-16,20,25H,5,8,13,17H2,1-3H3,(H,31,33) |
| InChIKey | FPRCRBBPFXVINM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|