C26H21FN2O5 — CID 17361913
N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-fluorobenzamide (PubChem CID 17361913) has the molecular formula C26H21FN2O5 and a molecular weight of 460.46 g/mol. Its IUPAC name is N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-fluorobenzamide.
| Compound Name | N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 17361913 |
| Molecular Formula | C26H21FN2O5 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-fluorobenzamide |
| SMILES | O=C(Nc1cccc(Oc2ccc3c(c2)C(=O)N(CC2CCCO2)C3=O)c1)c1ccccc1F |
| InChI | InChI=1S/C26H21FN2O5/c27-23-9-2-1-8-21(23)24(30)28-16-5-3-6-17(13-16)34-18-10-11-20-22(14-18)26(32)29(25(20)31)15-19-7-4-12-33-19/h1-3,5-6,8-11,13-14,19H,4,7,12,15H2,(H,28,30) |
| InChIKey | QTIKTEQZHDSQBY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|