C29H26N2O7 — CID 17362437
[3-[[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]carbamoyl]phenyl] propanoate (PubChem CID 17362437) has the molecular formula C29H26N2O7 and a molecular weight of 514.53 g/mol. Its IUPAC name is [3-[[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]carbamoyl]phenyl] propanoate.
| Compound Name | [3-[[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]carbamoyl]phenyl] propanoate |
|---|---|
| PubChem CID | 17362437 |
| Molecular Formula | C29H26N2O7 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | [3-[[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]carbamoyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(C(=O)Nc2ccc(Oc3ccc4c(c3)C(=O)N(CC3CCCO3)C4=O)cc2)c1 |
| InChI | InChI=1S/C29H26N2O7/c1-2-26(32)38-21-6-3-5-18(15-21)27(33)30-19-8-10-20(11-9-19)37-22-12-13-24-25(16-22)29(35)31(28(24)34)17-23-7-4-14-36-23/h3,5-6,8-13,15-16,23H,2,4,7,14,17H2,1H3,(H,30,33) |
| InChIKey | ZGBKMVKBPCOLPN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|