C33H31N3O7 — CID 17362546
N-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 17362546) has the molecular formula C33H31N3O7 and a molecular weight of 581.63 g/mol. Its IUPAC name is N-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 17362546 |
| Molecular Formula | C33H31N3O7 |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | N-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CC(C)CCN1C(=O)c2ccc(C(=O)Nc3ccc(Oc4ccc5c(c4)C(=O)N(CC4CCCO4)C5=O)cc3)cc2C1=O |
| InChI | InChI=1S/C33H31N3O7/c1-19(2)13-14-35-30(38)25-11-5-20(16-27(25)32(35)40)29(37)34-21-6-8-22(9-7-21)43-23-10-12-26-28(17-23)33(41)36(31(26)39)18-24-4-3-15-42-24/h5-12,16-17,19,24H,3-4,13-15,18H2,1-2H3,(H,34,37) |
| InChIKey | POJPKZUCROVTBE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|