C28H26N2O7 — CID 17362493
N-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-(4-methoxyphenoxy)acetamide (PubChem CID 17362493) has the molecular formula C28H26N2O7 and a molecular weight of 502.52 g/mol. Its IUPAC name is N-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-(4-methoxyphenoxy)acetamide.
| Compound Name | N-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-(4-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 17362493 |
| Molecular Formula | C28H26N2O7 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | N-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-(4-methoxyphenoxy)acetamide |
| SMILES | COc1ccc(OCC(=O)Nc2ccc(Oc3ccc4c(c3)C(=O)N(CC3CCCO3)C4=O)cc2)cc1 |
| InChI | InChI=1S/C28H26N2O7/c1-34-19-8-10-20(11-9-19)36-17-26(31)29-18-4-6-21(7-5-18)37-22-12-13-24-25(15-22)28(33)30(27(24)32)16-23-3-2-14-35-23/h4-13,15,23H,2-3,14,16-17H2,1H3,(H,29,31) |
| InChIKey | UBZFJRHTHFIZSJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|