C27H22Cl2N2O6 — CID 17362023
2-(2,4-dichlorophenoxy)-N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]acetamide (PubChem CID 17362023) has the molecular formula C27H22Cl2N2O6 and a molecular weight of 541.39 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]acetamide |
|---|---|
| PubChem CID | 17362023 |
| Molecular Formula | C27H22Cl2N2O6 |
| Molecular Weight | 541.39 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)Nc1cccc(Oc2ccc3c(c2)C(=O)N(CC2CCCO2)C3=O)c1 |
| InChI | InChI=1S/C27H22Cl2N2O6/c28-16-6-9-24(23(29)11-16)36-15-25(32)30-17-3-1-4-18(12-17)37-19-7-8-21-22(13-19)27(34)31(26(21)33)14-20-5-2-10-35-20/h1,3-4,6-9,11-13,20H,2,5,10,14-15H2,(H,30,32) |
| InChIKey | UTPMOCBQEXLDMP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.39 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|