C30H25N3O7 — CID 17362062
3-(1,3-dioxoisoindol-2-yl)-N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]propanamide (PubChem CID 17362062) has the molecular formula C30H25N3O7 and a molecular weight of 539.54 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]propanamide |
|---|---|
| PubChem CID | 17362062 |
| Molecular Formula | C30H25N3O7 |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]propanamide |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)Nc1cccc(Oc2ccc3c(c2)C(=O)N(CC2CCCO2)C3=O)c1 |
| InChI | InChI=1S/C30H25N3O7/c34-26(12-13-32-27(35)22-8-1-2-9-23(22)28(32)36)31-18-5-3-6-19(15-18)40-20-10-11-24-25(16-20)30(38)33(29(24)37)17-21-7-4-14-39-21/h1-3,5-6,8-11,15-16,21H,4,7,12-14,17H2,(H,31,34) |
| InChIKey | LMFMOCKJRWYXCQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|