C28H25N3O7S — CID 17362103
N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-[(4-nitrophenyl)methylsulfanyl]acetamide (PubChem CID 17362103) has the molecular formula C28H25N3O7S and a molecular weight of 547.59 g/mol. Its IUPAC name is N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-[(4-nitrophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-[(4-nitrophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 17362103 |
| Molecular Formula | C28H25N3O7S |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | N-[3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]-2-[(4-nitrophenyl)methylsulfanyl]acetamide |
| SMILES | O=C(CSCc1ccc([N+](=O)[O-])cc1)Nc1cccc(Oc2ccc3c(c2)C(=O)N(CC2CCCO2)C3=O)c1 |
| InChI | InChI=1S/C28H25N3O7S/c32-26(17-39-16-18-6-8-20(9-7-18)31(35)36)29-19-3-1-4-21(13-19)38-22-10-11-24-25(14-22)28(34)30(27(24)33)15-23-5-2-12-37-23/h1,3-4,6-11,13-14,23H,2,5,12,15-17H2,(H,29,32) |
| InChIKey | FRTGASGYTHBIJP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|