C25H22N2O8S — CID 17296798
dimethyl 4-[3-[[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]phenoxy]benzene-1,2-dicarboxylate (PubChem CID 17296798) has the molecular formula C25H22N2O8S and a molecular weight of 510.52 g/mol. Its IUPAC name is dimethyl 4-[3-[[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]phenoxy]benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-[3-[[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]phenoxy]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 17296798 |
| Molecular Formula | C25H22N2O8S |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | dimethyl 4-[3-[[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]phenoxy]benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(Oc2cccc(NC(=O)CSCc3ccc([N+](=O)[O-])cc3)c2)cc1C(=O)OC |
| InChI | InChI=1S/C25H22N2O8S/c1-33-24(29)21-11-10-20(13-22(21)25(30)34-2)35-19-5-3-4-17(12-19)26-23(28)15-36-14-16-6-8-18(9-7-16)27(31)32/h3-13H,14-15H2,1-2H3,(H,26,28) |
| InChIKey | JNDVACCPUOFXPY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|