C28H25ClN2O6 — CID 17362492
2-(4-chloro-2-methylphenoxy)-N-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]acetamide (PubChem CID 17362492) has the molecular formula C28H25ClN2O6 and a molecular weight of 520.97 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]acetamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]acetamide |
|---|---|
| PubChem CID | 17362492 |
| Molecular Formula | C28H25ClN2O6 |
| Molecular Weight | 520.97 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]oxyphenyl]acetamide |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)Nc1ccc(Oc2ccc3c(c2)C(=O)N(CC2CCCO2)C3=O)cc1 |
| InChI | InChI=1S/C28H25ClN2O6/c1-17-13-18(29)4-11-25(17)36-16-26(32)30-19-5-7-20(8-6-19)37-21-9-10-23-24(14-21)28(34)31(27(23)33)15-22-3-2-12-35-22/h4-11,13-14,22H,2-3,12,15-16H2,1H3,(H,30,32) |
| InChIKey | GEBUAKPACQBKIT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.97 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|