C16H20N2O5 — CID 168596190
5-(2,3-dihydroxypropylamino)-2-(oxolan-2-ylmethyl)isoindole-1,3-dione (PubChem CID 168596190) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is 5-(2,3-dihydroxypropylamino)-2-(oxolan-2-ylmethyl)isoindole-1,3-dione.
| Compound Name | 5-(2,3-dihydroxypropylamino)-2-(oxolan-2-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168596190 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 5-(2,3-dihydroxypropylamino)-2-(oxolan-2-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccc(NCC(O)CO)cc2C(=O)N1CC1CCCO1 |
| InChI | InChI=1S/C16H20N2O5/c19-9-11(20)7-17-10-3-4-13-14(6-10)16(22)18(15(13)21)8-12-2-1-5-23-12/h3-4,6,11-12,17,19-20H,1-2,5,7-9H2 |
| InChIKey | VVBOKVWXZQEMKZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|