C21H18BrFN2O4 — CID 55907000
N-[(3-bromo-5-fluorophenyl)methyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide (PubChem CID 55907000) has the molecular formula C21H18BrFN2O4 and a molecular weight of 461.29 g/mol. Its IUPAC name is N-[(3-bromo-5-fluorophenyl)methyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-[(3-bromo-5-fluorophenyl)methyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 55907000 |
| Molecular Formula | C21H18BrFN2O4 |
| Molecular Weight | 461.29 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | N-[(3-bromo-5-fluorophenyl)methyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
| SMILES | O=C(NCc1cc(F)cc(Br)c1)c1ccc2c(c1)C(=O)N(CC1CCCO1)C2=O |
| InChI | InChI=1S/C21H18BrFN2O4/c22-14-6-12(7-15(23)9-14)10-24-19(26)13-3-4-17-18(8-13)21(28)25(20(17)27)11-16-2-1-5-29-16/h3-4,6-9,16H,1-2,5,10-11H2,(H,24,26) |
| InChIKey | FSUQKNLOSJWCQU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|