C23H17N5O4 — CID 38432437
2-(furan-2-ylmethyl)-1,3-dioxo-N-[(2-pyrazol-1-yl-3-pyridinyl)methyl]isoindole-5-carboxamide (PubChem CID 38432437) has the molecular formula C23H17N5O4 and a molecular weight of 427.42 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)-1,3-dioxo-N-[(2-pyrazol-1-yl-3-pyridinyl)methyl]isoindole-5-carboxamide.
| Compound Name | 2-(furan-2-ylmethyl)-1,3-dioxo-N-[(2-pyrazol-1-yl-3-pyridinyl)methyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 38432437 |
| Molecular Formula | C23H17N5O4 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-(furan-2-ylmethyl)-1,3-dioxo-N-[(2-pyrazol-1-yl-3-pyridinyl)methyl]isoindole-5-carboxamide |
| SMILES | O=C(NCc1cccnc1-n1cccn1)c1ccc2c(c1)C(=O)N(Cc1ccco1)C2=O |
| InChI | InChI=1S/C23H17N5O4/c29-21(25-13-16-4-1-8-24-20(16)28-10-3-9-26-28)15-6-7-18-19(12-15)23(31)27(22(18)30)14-17-5-2-11-32-17/h1-12H,13-14H2,(H,25,29) |
| InChIKey | BGGBRWYXODEXBD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|