C24H20N2O7 — CID 166435048
methyl 5-[[[2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carbonyl]amino]methyl]-2-methoxybenzoate (PubChem CID 166435048) has the molecular formula C24H20N2O7 and a molecular weight of 448.43 g/mol. Its IUPAC name is methyl 5-[[[2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carbonyl]amino]methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[[[2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carbonyl]amino]methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 166435048 |
| Molecular Formula | C24H20N2O7 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | methyl 5-[[[2-(furan-2-ylmethyl)-1,3-dioxoisoindole-5-carbonyl]amino]methyl]-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(CNC(=O)c2ccc3c(c2)C(=O)N(Cc2ccco2)C3=O)ccc1OC |
| InChI | InChI=1S/C24H20N2O7/c1-31-20-8-5-14(10-19(20)24(30)32-2)12-25-21(27)15-6-7-17-18(11-15)23(29)26(22(17)28)13-16-4-3-9-33-16/h3-11H,12-13H2,1-2H3,(H,25,27) |
| InChIKey | NFXFVSHHNUSLMY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|