C15H15NO5 — CID 51265623
methyl 5-[(furan-3-carbonylamino)methyl]-2-methoxybenzoate (PubChem CID 51265623) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is methyl 5-[(furan-3-carbonylamino)methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[(furan-3-carbonylamino)methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 51265623 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | methyl 5-[(furan-3-carbonylamino)methyl]-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(CNC(=O)c2ccoc2)ccc1OC |
| InChI | InChI=1S/C15H15NO5/c1-19-13-4-3-10(7-12(13)15(18)20-2)8-16-14(17)11-5-6-21-9-11/h3-7,9H,8H2,1-2H3,(H,16,17) |
| InChIKey | ZLULDWUWLKPBPK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |