C14H15NO4 — CID 146076174
methyl 5-[(but-2-ynoylamino)methyl]-2-methoxybenzoate (PubChem CID 146076174) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is methyl 5-[(but-2-ynoylamino)methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[(but-2-ynoylamino)methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 146076174 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | methyl 5-[(but-2-ynoylamino)methyl]-2-methoxybenzoate |
| SMILES | CC#CC(=O)NCc1ccc(OC)c(C(=O)OC)c1 |
| InChI | InChI=1S/C14H15NO4/c1-4-5-13(16)15-9-10-6-7-12(18-2)11(8-10)14(17)19-3/h6-8H,9H2,1-3H3,(H,15,16) |
| InChIKey | FJNDNGZJNKDPBZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|