C24H22N2O6 — CID 56545707
methyl 5-[[[4-(4-carbamoylphenoxy)benzoyl]amino]methyl]-2-methoxybenzoate (PubChem CID 56545707) has the molecular formula C24H22N2O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is methyl 5-[[[4-(4-carbamoylphenoxy)benzoyl]amino]methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[[[4-(4-carbamoylphenoxy)benzoyl]amino]methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 56545707 |
| Molecular Formula | C24H22N2O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | methyl 5-[[[4-(4-carbamoylphenoxy)benzoyl]amino]methyl]-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(CNC(=O)c2ccc(Oc3ccc(C(N)=O)cc3)cc2)ccc1OC |
| InChI | InChI=1S/C24H22N2O6/c1-30-21-12-3-15(13-20(21)24(29)31-2)14-26-23(28)17-6-10-19(11-7-17)32-18-8-4-16(5-9-18)22(25)27/h3-13H,14H2,1-2H3,(H2,25,27)(H,26,28) |
| InChIKey | ANCPTZFZPRMNAZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |