C26H24N4O6 — CID 66585406
N-[[4-(4-carbamoylphenoxy)phenyl]methyl]-5-[(2,4-dioxoimidazolidin-1-yl)methyl]-2-methoxybenzamide (PubChem CID 66585406) has the molecular formula C26H24N4O6 and a molecular weight of 488.50 g/mol. Its IUPAC name is N-[[4-(4-carbamoylphenoxy)phenyl]methyl]-5-[(2,4-dioxoimidazolidin-1-yl)methyl]-2-methoxybenzamide.
| Compound Name | N-[[4-(4-carbamoylphenoxy)phenyl]methyl]-5-[(2,4-dioxoimidazolidin-1-yl)methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 66585406 |
| Molecular Formula | C26H24N4O6 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | N-[[4-(4-carbamoylphenoxy)phenyl]methyl]-5-[(2,4-dioxoimidazolidin-1-yl)methyl]-2-methoxybenzamide |
| SMILES | COc1ccc(CN2CC(=O)NC2=O)cc1C(=O)NCc1ccc(Oc2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C26H24N4O6/c1-35-22-11-4-17(14-30-15-23(31)29-26(30)34)12-21(22)25(33)28-13-16-2-7-19(8-3-16)36-20-9-5-18(6-10-20)24(27)32/h2-12H,13-15H2,1H3,(H2,27,32)(H,28,33)(H,29,31,34) |
| InChIKey | LFTJJEODUFZBSM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|