C26H23N3O7 — CID 66585371
4-[4-[[[5-[(2,4-dioxoimidazolidin-1-yl)methyl]-2-methoxybenzoyl]amino]methyl]phenoxy]benzoic acid (PubChem CID 66585371) has the molecular formula C26H23N3O7 and a molecular weight of 489.48 g/mol. Its IUPAC name is 4-[4-[[[5-[(2,4-dioxoimidazolidin-1-yl)methyl]-2-methoxybenzoyl]amino]methyl]phenoxy]benzoic acid.
| Compound Name | 4-[4-[[[5-[(2,4-dioxoimidazolidin-1-yl)methyl]-2-methoxybenzoyl]amino]methyl]phenoxy]benzoic acid |
|---|---|
| PubChem CID | 66585371 |
| Molecular Formula | C26H23N3O7 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 4-[4-[[[5-[(2,4-dioxoimidazolidin-1-yl)methyl]-2-methoxybenzoyl]amino]methyl]phenoxy]benzoic acid |
| SMILES | COc1ccc(CN2CC(=O)NC2=O)cc1C(=O)NCc1ccc(Oc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C26H23N3O7/c1-35-22-11-4-17(14-29-15-23(30)28-26(29)34)12-21(22)24(31)27-13-16-2-7-19(8-3-16)36-20-9-5-18(6-10-20)25(32)33/h2-12H,13-15H2,1H3,(H,27,31)(H,32,33)(H,28,30,34) |
| InChIKey | GMROHNUILGEKBL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|