C25H26N2O4 — CID 56548843
4-[4-[(3-butoxyphenyl)methylcarbamoyl]phenoxy]benzamide (PubChem CID 56548843) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 4-[4-[(3-butoxyphenyl)methylcarbamoyl]phenoxy]benzamide.
| Compound Name | 4-[4-[(3-butoxyphenyl)methylcarbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 56548843 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 4-[4-[(3-butoxyphenyl)methylcarbamoyl]phenoxy]benzamide |
| SMILES | CCCCOc1cccc(CNC(=O)c2ccc(Oc3ccc(C(N)=O)cc3)cc2)c1 |
| InChI | InChI=1S/C25H26N2O4/c1-2-3-15-30-23-6-4-5-18(16-23)17-27-25(29)20-9-13-22(14-10-20)31-21-11-7-19(8-12-21)24(26)28/h4-14,16H,2-3,15,17H2,1H3,(H2,26,28)(H,27,29) |
| InChIKey | JLXLMBYMSNMGNK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|