C21H18N2O3 — CID 32636499
3-[[(3-phenoxybenzoyl)amino]methyl]benzamide (PubChem CID 32636499) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-[[(3-phenoxybenzoyl)amino]methyl]benzamide.
| Compound Name | 3-[[(3-phenoxybenzoyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 32636499 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 3-[[(3-phenoxybenzoyl)amino]methyl]benzamide |
| SMILES | NC(=O)c1cccc(CNC(=O)c2cccc(Oc3ccccc3)c2)c1 |
| InChI | InChI=1S/C21H18N2O3/c22-20(24)16-7-4-6-15(12-16)14-23-21(25)17-8-5-11-19(13-17)26-18-9-2-1-3-10-18/h1-13H,14H2,(H2,22,24)(H,23,25) |
| InChIKey | HDNBHMMAPZIFFU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |