C19H16N2O4 — CID 71863392
N-[(3-carbamoylphenyl)methyl]-5-phenoxyfuran-2-carboxamide (PubChem CID 71863392) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is N-[(3-carbamoylphenyl)methyl]-5-phenoxyfuran-2-carboxamide.
| Compound Name | N-[(3-carbamoylphenyl)methyl]-5-phenoxyfuran-2-carboxamide |
|---|---|
| PubChem CID | 71863392 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[(3-carbamoylphenyl)methyl]-5-phenoxyfuran-2-carboxamide |
| SMILES | NC(=O)c1cccc(CNC(=O)c2ccc(Oc3ccccc3)o2)c1 |
| InChI | InChI=1S/C19H16N2O4/c20-18(22)14-6-4-5-13(11-14)12-21-19(23)16-9-10-17(25-16)24-15-7-2-1-3-8-15/h1-11H,12H2,(H2,20,22)(H,21,23) |
| InChIKey | WXVDVDZHRIIKOP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |