C36H40N2O2 — CID 143013733
4-butyl-N-[[3-[4-[1-(4-butylphenyl)ethenylamino]phenoxy]phenyl]methyl]benzamide (PubChem CID 143013733) has the molecular formula C36H40N2O2 and a molecular weight of 532.73 g/mol. Its IUPAC name is 4-butyl-N-[[3-[4-[1-(4-butylphenyl)ethenylamino]phenoxy]phenyl]methyl]benzamide.
| Compound Name | 4-butyl-N-[[3-[4-[1-(4-butylphenyl)ethenylamino]phenoxy]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 143013733 |
| Molecular Formula | C36H40N2O2 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | 4-butyl-N-[[3-[4-[1-(4-butylphenyl)ethenylamino]phenoxy]phenyl]methyl]benzamide |
| SMILES | C=C(Nc1ccc(Oc2cccc(CNC(=O)c3ccc(CCCC)cc3)c2)cc1)c1ccc(CCCC)cc1 |
| InChI | InChI=1S/C36H40N2O2/c1-4-6-9-28-13-17-31(18-14-28)27(3)38-33-21-23-34(24-22-33)40-35-12-8-11-30(25-35)26-37-36(39)32-19-15-29(16-20-32)10-7-5-2/h8,11-25,38H,3-7,9-10,26H2,1-2H3,(H,37,39) |
| InChIKey | LSTVRSSNYRASIN-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |