C24H22N2O2 — CID 44723465
4-butyl-N-[4-(4-cyanophenoxy)phenyl]benzamide (PubChem CID 44723465) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-butyl-N-[4-(4-cyanophenoxy)phenyl]benzamide.
| Compound Name | 4-butyl-N-[4-(4-cyanophenoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 44723465 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-butyl-N-[4-(4-cyanophenoxy)phenyl]benzamide |
| SMILES | CCCCc1ccc(C(=O)Nc2ccc(Oc3ccc(C#N)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H22N2O2/c1-2-3-4-18-5-9-20(10-6-18)24(27)26-21-11-15-23(16-12-21)28-22-13-7-19(17-25)8-14-22/h5-16H,2-4H2,1H3,(H,26,27) |
| InChIKey | QZWBFCYUAQZWGH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |