C39H40N2O3 — CID 173155425
4-[4-[2-(hydroxyamino)-2-(3-phenoxyphenyl)ethyl]phenyl]-N-[(4-pentylphenyl)methyl]benzamide (PubChem CID 173155425) has the molecular formula C39H40N2O3 and a molecular weight of 584.76 g/mol. Its IUPAC name is 4-[4-[2-(hydroxyamino)-2-(3-phenoxyphenyl)ethyl]phenyl]-N-[(4-pentylphenyl)methyl]benzamide.
| Compound Name | 4-[4-[2-(hydroxyamino)-2-(3-phenoxyphenyl)ethyl]phenyl]-N-[(4-pentylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 173155425 |
| Molecular Formula | C39H40N2O3 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | 4-[4-[2-(hydroxyamino)-2-(3-phenoxyphenyl)ethyl]phenyl]-N-[(4-pentylphenyl)methyl]benzamide |
| SMILES | CCCCCc1ccc(CNC(=O)c2ccc(-c3ccc(CC(NO)c4cccc(Oc5ccccc5)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H40N2O3/c1-2-3-5-9-29-14-16-31(17-15-29)28-40-39(42)34-24-22-33(23-25-34)32-20-18-30(19-21-32)26-38(41-43)35-10-8-13-37(27-35)44-36-11-6-4-7-12-36/h4,6-8,10-25,27,38,41,43H,2-3,5,9,26,28H2,1H3,(H,40,42) |
| InChIKey | NICLXIURRMQPTI-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|